C23H25ClF2N6O7 — CID 155103146
tert-butyl N-[6-chloro-3-[1-[(2,3-difluoro-4-methoxy-5-nitrophenyl)methoxy]propan-2-ylcarbamoyl]imidazo[1,2-b]pyridazin-8-yl]carbamate (PubChem CID 155103146) has the molecular formula C23H25ClF2N6O7 and a molecular weight of 570.94 g/mol. Its IUPAC name is tert-butyl N-[6-chloro-3-[1-[(2,3-difluoro-4-methoxy-5-nitrophenyl)methoxy]propan-2-ylcarbamoyl]imidazo[1,2-b]pyridazin-8-yl]carbamate.
| Compound Name | tert-butyl N-[6-chloro-3-[1-[(2,3-difluoro-4-methoxy-5-nitrophenyl)methoxy]propan-2-ylcarbamoyl]imidazo[1,2-b]pyridazin-8-yl]carbamate |
|---|---|
| PubChem CID | 155103146 |
| Molecular Formula | C23H25ClF2N6O7 |
| Molecular Weight | 570.94 g/mol |
| Exact Mass | 570.14 |
| IUPAC Name | tert-butyl N-[6-chloro-3-[1-[(2,3-difluoro-4-methoxy-5-nitrophenyl)methoxy]propan-2-ylcarbamoyl]imidazo[1,2-b]pyridazin-8-yl]carbamate |
| SMILES | COc1c([N+](=O)[O-])cc(COCC(C)NC(=O)c2cnc3c(NC(=O)OC(C)(C)C)cc(Cl)nn23)c(F)c1F |
| InChI | InChI=1S/C23H25ClF2N6O7/c1-11(9-38-10-12-6-14(32(35)36)19(37-5)18(26)17(12)25)28-21(33)15-8-27-20-13(7-16(24)30-31(15)20)29-22(34)39-23(2,3)4/h6-8,11H,9-10H2,1-5H3,(H,28,33)(H,29,34) |
| InChIKey | IJKQWBWACYOWMD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 159.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.94 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|