C18H21FN6O5S — CID 155103180
N-[(1,5-dimethylpyrazol-4-yl)methyl]-8-fluoro-6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxamide (PubChem CID 155103180) has the molecular formula C18H21FN6O5S and a molecular weight of 452.47 g/mol. Its IUPAC name is N-[(1,5-dimethylpyrazol-4-yl)methyl]-8-fluoro-6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxamide.
| Compound Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-8-fluoro-6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxamide |
|---|---|
| PubChem CID | 155103180 |
| Molecular Formula | C18H21FN6O5S |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-8-fluoro-6-hydroxy-7-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| SMILES | Cc1c(CNC(=O)N2CCc3cc(O)c(N4CC(=O)NS4(=O)=O)c(F)c3C2)cnn1C |
| InChI | InChI=1S/C18H21FN6O5S/c1-10-12(7-21-23(10)2)6-20-18(28)24-4-3-11-5-14(26)17(16(19)13(11)8-24)25-9-15(27)22-31(25,29)30/h5,7,26H,3-4,6,8-9H2,1-2H3,(H,20,28)(H,22,27) |
| InChIKey | LDCXIIOGTLHUNT-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |