C18H24FN3O4S — CID 155103192
5-[(7R)-7-(2-cyclobutylethylamino)-1-fluoro-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 155103192) has the molecular formula C18H24FN3O4S and a molecular weight of 397.47 g/mol. Its IUPAC name is 5-[(7R)-7-(2-cyclobutylethylamino)-1-fluoro-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[(7R)-7-(2-cyclobutylethylamino)-1-fluoro-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 155103192 |
| Molecular Formula | C18H24FN3O4S |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 5-[(7R)-7-(2-cyclobutylethylamino)-1-fluoro-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | O=C1CN(c2c(O)cc3c(c2F)C[C@H](NCCC2CCC2)CC3)S(=O)(=O)N1 |
| InChI | InChI=1S/C18H24FN3O4S/c19-17-14-9-13(20-7-6-11-2-1-3-11)5-4-12(14)8-15(23)18(17)22-10-16(24)21-27(22,25)26/h8,11,13,20,23H,1-7,9-10H2,(H,21,24)/t13-/m1/s1 |
| InChIKey | CHROGQSZIDZWIA-CYBMUJFWSA-N |
| XLogP | 1.35 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |