C16H19F4N3O4S — CID 155103201
5-[(7R)-1-fluoro-3-hydroxy-7-(4,4,4-trifluorobutylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 155103201) has the molecular formula C16H19F4N3O4S and a molecular weight of 425.40 g/mol. Its IUPAC name is 5-[(7R)-1-fluoro-3-hydroxy-7-(4,4,4-trifluorobutylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[(7R)-1-fluoro-3-hydroxy-7-(4,4,4-trifluorobutylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 155103201 |
| Molecular Formula | C16H19F4N3O4S |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 5-[(7R)-1-fluoro-3-hydroxy-7-(4,4,4-trifluorobutylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | O=C1CN(c2c(O)cc3c(c2F)C[C@H](NCCCC(F)(F)F)CC3)S(=O)(=O)N1 |
| InChI | InChI=1S/C16H19F4N3O4S/c17-14-11-7-10(21-5-1-4-16(18,19)20)3-2-9(11)6-12(24)15(14)23-8-13(25)22-28(23,26)27/h6,10,21,24H,1-5,7-8H2,(H,22,25)/t10-/m1/s1 |
| InChIKey | XOKRBZDSHIPOOM-SNVBAGLBSA-N |
| XLogP | 1.50 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|