C19H26FN3O4S — CID 155103241
5-[(7R)-7-(2-cyclopentylethylamino)-1-fluoro-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 155103241) has the molecular formula C19H26FN3O4S and a molecular weight of 411.50 g/mol. Its IUPAC name is 5-[(7R)-7-(2-cyclopentylethylamino)-1-fluoro-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[(7R)-7-(2-cyclopentylethylamino)-1-fluoro-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 155103241 |
| Molecular Formula | C19H26FN3O4S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 5-[(7R)-7-(2-cyclopentylethylamino)-1-fluoro-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | O=C1CN(c2c(O)cc3c(c2F)C[C@H](NCCC2CCCC2)CC3)S(=O)(=O)N1 |
| InChI | InChI=1S/C19H26FN3O4S/c20-18-15-10-14(21-8-7-12-3-1-2-4-12)6-5-13(15)9-16(24)19(18)23-11-17(25)22-28(23,26)27/h9,12,14,21,24H,1-8,10-11H2,(H,22,25)/t14-/m1/s1 |
| InChIKey | XUZOOEPQVHBOAK-CQSZACIVSA-N |
| XLogP | 1.74 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |