C17H20FN5O4S — CID 155103243
5-[2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-8-fluoro-6-hydroxy-3,4-dihydro-1H-isoquinolin-7-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 155103243) has the molecular formula C17H20FN5O4S and a molecular weight of 409.44 g/mol. Its IUPAC name is 5-[2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-8-fluoro-6-hydroxy-3,4-dihydro-1H-isoquinolin-7-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-8-fluoro-6-hydroxy-3,4-dihydro-1H-isoquinolin-7-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 155103243 |
| Molecular Formula | C17H20FN5O4S |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 5-[2-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-8-fluoro-6-hydroxy-3,4-dihydro-1H-isoquinolin-7-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | Cc1n[nH]c(C)c1CN1CCc2cc(O)c(N3CC(=O)NS3(=O)=O)c(F)c2C1 |
| InChI | InChI=1S/C17H20FN5O4S/c1-9-12(10(2)20-19-9)6-22-4-3-11-5-14(24)17(16(18)13(11)7-22)23-8-15(25)21-28(23,26)27/h5,24H,3-4,6-8H2,1-2H3,(H,19,20)(H,21,25) |
| InChIKey | STXBXNSUTDDJEA-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 118.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |