C18H22FN5O4S — CID 155103244
5-[2-[2-(1,3-dimethylpyrazol-4-yl)ethyl]-8-fluoro-6-hydroxy-3,4-dihydro-1H-isoquinolin-7-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 155103244) has the molecular formula C18H22FN5O4S and a molecular weight of 423.47 g/mol. Its IUPAC name is 5-[2-[2-(1,3-dimethylpyrazol-4-yl)ethyl]-8-fluoro-6-hydroxy-3,4-dihydro-1H-isoquinolin-7-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[2-[2-(1,3-dimethylpyrazol-4-yl)ethyl]-8-fluoro-6-hydroxy-3,4-dihydro-1H-isoquinolin-7-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 155103244 |
| Molecular Formula | C18H22FN5O4S |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 5-[2-[2-(1,3-dimethylpyrazol-4-yl)ethyl]-8-fluoro-6-hydroxy-3,4-dihydro-1H-isoquinolin-7-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | Cc1nn(C)cc1CCN1CCc2cc(O)c(N3CC(=O)NS3(=O)=O)c(F)c2C1 |
| InChI | InChI=1S/C18H22FN5O4S/c1-11-13(8-22(2)20-11)4-6-23-5-3-12-7-15(25)18(17(19)14(12)9-23)24-10-16(26)21-29(24,27)28/h7-8,25H,3-6,9-10H2,1-2H3,(H,21,26) |
| InChIKey | YUZWQBPDPGKAPN-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |