C17H22FN3O4S — CID 155103255
5-[(7R)-7-(2-cyclopropylethylamino)-1-fluoro-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 155103255) has the molecular formula C17H22FN3O4S and a molecular weight of 383.45 g/mol. Its IUPAC name is 5-[(7R)-7-(2-cyclopropylethylamino)-1-fluoro-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[(7R)-7-(2-cyclopropylethylamino)-1-fluoro-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 155103255 |
| Molecular Formula | C17H22FN3O4S |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 5-[(7R)-7-(2-cyclopropylethylamino)-1-fluoro-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | O=C1CN(c2c(O)cc3c(c2F)C[C@H](NCCC2CC2)CC3)S(=O)(=O)N1 |
| InChI | InChI=1S/C17H22FN3O4S/c18-16-13-8-12(19-6-5-10-1-2-10)4-3-11(13)7-14(22)17(16)21-9-15(23)20-26(21,24)25/h7,10,12,19,22H,1-6,8-9H2,(H,20,23)/t12-/m1/s1 |
| InChIKey | JUEOGEQLKIKONH-GFCCVEGCSA-N |
| XLogP | 0.96 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |