About 2-[6-(3a,7a-dihydroindazol-1-yl)-2-(4-pyridin-4-ylpiperazin-1-yl)purin-9-yl]acetic acid
2-[6-(3a,7a-dihydroindazol-1-yl)-2-(4-pyridin-4-ylpiperazin-1-yl)purin-9-yl]acetic acid (PubChem CID 155103866) has the molecular formula C23H23N9O2
and a molecular weight of 457.50 g/mol. Its IUPAC name is 2-[6-(3a,7a-dihydroindazol-1-yl)-2-(4-pyridin-4-ylpiperazin-1-yl)purin-9-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[6-(3a,7a-dihydroindazol-1-yl)-2-(4-pyridin-4-ylpiperazin-1-yl)purin-9-yl]acetic acid |
| PubChem CID | 155103866 |
| Molecular Formula | C23H23N9O2 |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 2-[6-(3a,7a-dihydroindazol-1-yl)-2-(4-pyridin-4-ylpiperazin-1-yl)purin-9-yl]acetic acid |
| SMILES | O=C(O)Cn1cnc2c(N3N=CC4C=CC=CC43)nc(N3CCN(c4ccncc4)CC3)nc21 |
| InChI | InChI=1S/C23H23N9O2/c33-19(34)14-31-15-25-20-21(31)27-23(28-22(20)32-18-4-2-1-3-16(18)13-26-32)30-11-9-29(10-12-30)17-5-7-24-8-6-17/h1-8,13,15-16,18H,9-12,14H2,(H,33,34) |
| InChIKey | USGBZXQMVODHFI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze 2-[6-(3a,7a-dihydroindazol-1-yl)-2-(4-pyridin-4-ylpiperazin-1-yl)purin-9-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(3a,7a-dihydroindazol-1-yl)-2-(4-pyridin-4-ylpiperazin-1-yl)purin-9-yl]acetic acid?
The IUPAC name of 2-[6-(3a,7a-dihydroindazol-1-yl)-2-(4-pyridin-4-ylpiperazin-1-yl)purin-9-yl]acetic acid (CID 155103866) is 2-[6-(3a,7a-dihydroindazol-1-yl)-2-(4-pyridin-4-ylpiperazin-1-yl)purin-9-yl]acetic acid.
What is the SMILES notation for 2-[6-(3a,7a-dihydroindazol-1-yl)-2-(4-pyridin-4-ylpiperazin-1-yl)purin-9-yl]acetic acid?
The canonical SMILES for 2-[6-(3a,7a-dihydroindazol-1-yl)-2-(4-pyridin-4-ylpiperazin-1-yl)purin-9-yl]acetic acid is O=C(O)Cn1cnc2c(N3N=CC4C=CC=CC43)nc(N3CCN(c4ccncc4)CC3)nc21.
What is the InChIKey of 2-[6-(3a,7a-dihydroindazol-1-yl)-2-(4-pyridin-4-ylpiperazin-1-yl)purin-9-yl]acetic acid?
The InChIKey is USGBZXQMVODHFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N9O2/c33-19(34)14-31-15-25-20-21(31)27-23(28-22(20)32-18-4-2-1-3-16(18)13-26-32)30-11-9-29(10-12-30)17-5-7-24-8-6-17/h1-8,13,15-16,18H,9-12,14H2,(H,33,34).
What are the key properties of 2-[6-(3a,7a-dihydroindazol-1-yl)-2-(4-pyridin-4-ylpiperazin-1-yl)purin-9-yl]acetic acid?
2-[6-(3a,7a-dihydroindazol-1-yl)-2-(4-pyridin-4-ylpiperazin-1-yl)purin-9-yl]acetic acid has a molecular weight of 457.50 g/mol, XLogP of 1.55, 5 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(3a,7a-dihydroindazol-1-yl)-2-(4-pyridin-4-ylpiperazin-1-yl)purin-9-yl]acetic acid is sourced from PubChem (CID 155103866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).