C8H12Cl6OS — CID 155104017
1,2,3,4,5,6-hexachlorocyclohexane;methylsulfinylmethane (PubChem CID 155104017) has the molecular formula C8H12Cl6OS and a molecular weight of 368.97 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexachlorocyclohexane;methylsulfinylmethane.
| Compound Name | 1,2,3,4,5,6-hexachlorocyclohexane;methylsulfinylmethane |
|---|---|
| PubChem CID | 155104017 |
| Molecular Formula | C8H12Cl6OS |
| Molecular Weight | 368.97 g/mol |
| Exact Mass | 365.87 |
| IUPAC Name | 1,2,3,4,5,6-hexachlorocyclohexane;methylsulfinylmethane |
| SMILES | CS(C)=O.ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl |
| InChI | InChI=1S/C6H6Cl6.C2H6OS/c7-1-2(8)4(10)6(12)5(11)3(1)9;1-4(2)3/h1-6H;1-2H3 |
| InChIKey | QLGKDCVRRSZKGZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.97 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|