C10H9Cl2N3 — CID 155104059
10,11-dichloro-4,8,9-triazatricyclo[7.4.0.02,7]trideca-1,7,10,12-tetraene (PubChem CID 155104059) has the molecular formula C10H9Cl2N3 and a molecular weight of 242.11 g/mol. Its IUPAC name is 10,11-dichloro-4,8,9-triazatricyclo[7.4.0.02,7]trideca-1,7,10,12-tetraene.
| Compound Name | 10,11-dichloro-4,8,9-triazatricyclo[7.4.0.02,7]trideca-1,7,10,12-tetraene |
|---|---|
| PubChem CID | 155104059 |
| Molecular Formula | C10H9Cl2N3 |
| Molecular Weight | 242.11 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 10,11-dichloro-4,8,9-triazatricyclo[7.4.0.02,7]trideca-1,7,10,12-tetraene |
| SMILES | Clc1ccc2c3c(nn2c1Cl)CCNC3 |
| InChI | InChI=1S/C10H9Cl2N3/c11-7-1-2-9-6-5-13-4-3-8(6)14-15(9)10(7)12/h1-2,13H,3-5H2 |
| InChIKey | FOYKOASWAJUKOX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.11 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|