acetaldehyde;(2R)-2-amino-4-methylpentanoic acid

C8H17NO3 — CID 155104074

IUPACacetaldehyde;(2R)-2-amino-4-methylpentanoic acid
SMILESCC(C)C[C@@H](N)C(=O)O.CC=O
InChIInChI=1S/C6H13NO2.C2H4O/c1-4(2)3-5(7)6(8)9;1-2-3/h4-5H,3,7H2,1-2H3,(H,8,9);2H,1H3/t5-;/m1./s1
InChIKeyKLXXUGKZRYKKMV-NUBCRITNSA-N
MW175.23 g/mol
LogP0.65
Rot. Bonds3

About acetaldehyde;(2R)-2-amino-4-methylpentanoic acid

acetaldehyde;(2R)-2-amino-4-methylpentanoic acid (PubChem CID 155104074) has the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. Its IUPAC name is acetaldehyde;(2R)-2-amino-4-methylpentanoic acid.

Molecular Properties

Compound Nameacetaldehyde;(2R)-2-amino-4-methylpentanoic acid
PubChem CID155104074
Molecular FormulaC8H17NO3
Molecular Weight175.23 g/mol
Exact Mass175.12
IUPAC Nameacetaldehyde;(2R)-2-amino-4-methylpentanoic acid
SMILESCC(C)C[C@@H](N)C(=O)O.CC=O
InChIInChI=1S/C6H13NO2.C2H4O/c1-4(2)3-5(7)6(8)9;1-2-3/h4-5H,3,7H2,1-2H3,(H,8,9);2H,1H3/t5-;/m1./s1
InChIKeyKLXXUGKZRYKKMV-NUBCRITNSA-N
XLogP0.65
TPSA80.39 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500175.23
LogP ≤ 50.65
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze acetaldehyde;(2R)-2-amino-4-methylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetaldehyde;(2R)-2-amino-4-methylpentanoic acid?
The IUPAC name of acetaldehyde;(2R)-2-amino-4-methylpentanoic acid (CID 155104074) is acetaldehyde;(2R)-2-amino-4-methylpentanoic acid.
What is the SMILES notation for acetaldehyde;(2R)-2-amino-4-methylpentanoic acid?
The canonical SMILES for acetaldehyde;(2R)-2-amino-4-methylpentanoic acid is CC(C)C[C@@H](N)C(=O)O.CC=O.
What is the InChIKey of acetaldehyde;(2R)-2-amino-4-methylpentanoic acid?
The InChIKey is KLXXUGKZRYKKMV-NUBCRITNSA-N. The full InChI is InChI=1S/C6H13NO2.C2H4O/c1-4(2)3-5(7)6(8)9;1-2-3/h4-5H,3,7H2,1-2H3,(H,8,9);2H,1H3/t5-;/m1./s1.
What are the key properties of acetaldehyde;(2R)-2-amino-4-methylpentanoic acid?
acetaldehyde;(2R)-2-amino-4-methylpentanoic acid has a molecular weight of 175.23 g/mol, XLogP of 0.65, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;(2R)-2-amino-4-methylpentanoic acid is sourced from PubChem (CID 155104074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).