C19H18F5N2O3+ — CID 155104108
1-[2-(difluoromethoxy)ethyl]-2-methyl-3-(4,4,4-trifluorobutyl)benzo[f]benzimidazol-3-ium-4,9-dione (PubChem CID 155104108) has the molecular formula C19H18F5N2O3+ and a molecular weight of 417.35 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)ethyl]-2-methyl-3-(4,4,4-trifluorobutyl)benzo[f]benzimidazol-3-ium-4,9-dione.
| Compound Name | 1-[2-(difluoromethoxy)ethyl]-2-methyl-3-(4,4,4-trifluorobutyl)benzo[f]benzimidazol-3-ium-4,9-dione |
|---|---|
| PubChem CID | 155104108 |
| Molecular Formula | C19H18F5N2O3+ |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 1-[2-(difluoromethoxy)ethyl]-2-methyl-3-(4,4,4-trifluorobutyl)benzo[f]benzimidazol-3-ium-4,9-dione |
| SMILES | Cc1n(CCOC(F)F)c2c([n+]1CCCC(F)(F)F)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H18F5N2O3/c1-11-25(8-4-7-19(22,23)24)14-15(26(11)9-10-29-18(20)21)17(28)13-6-3-2-5-12(13)16(14)27/h2-3,5-6,18H,4,7-10H2,1H3/q+1 |
| InChIKey | NCINRAQRAQUZFM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|