About (5-chloro-3-cyclobutylpyrazolo[1,5-a]pyrimidin-7-yl) N-(3-cyano-5-fluorophenyl)carbamate
(5-chloro-3-cyclobutylpyrazolo[1,5-a]pyrimidin-7-yl) N-(3-cyano-5-fluorophenyl)carbamate (PubChem CID 155104341) has the molecular formula C18H13ClFN5O2
and a molecular weight of 385.79 g/mol. Its IUPAC name is (5-chloro-3-cyclobutylpyrazolo[1,5-a]pyrimidin-7-yl) N-(3-cyano-5-fluorophenyl)carbamate.
Molecular Properties
| Compound Name | (5-chloro-3-cyclobutylpyrazolo[1,5-a]pyrimidin-7-yl) N-(3-cyano-5-fluorophenyl)carbamate |
| PubChem CID | 155104341 |
| Molecular Formula | C18H13ClFN5O2 |
| Molecular Weight | 385.79 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | (5-chloro-3-cyclobutylpyrazolo[1,5-a]pyrimidin-7-yl) N-(3-cyano-5-fluorophenyl)carbamate |
| SMILES | N#Cc1cc(F)cc(NC(=O)Oc2cc(Cl)nc3c(C4CCC4)cnn23)c1 |
| InChI | InChI=1S/C18H13ClFN5O2/c19-15-7-16(25-17(24-15)14(9-22-25)11-2-1-3-11)27-18(26)23-13-5-10(8-21)4-12(20)6-13/h4-7,9,11H,1-3H2,(H,23,26) |
| InChIKey | DJJFLBSEXGRVAN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.79 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (5-chloro-3-cyclobutylpyrazolo[1,5-a]pyrimidin-7-yl) N-(3-cyano-5-fluorophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-3-cyclobutylpyrazolo[1,5-a]pyrimidin-7-yl) N-(3-cyano-5-fluorophenyl)carbamate?
The IUPAC name of (5-chloro-3-cyclobutylpyrazolo[1,5-a]pyrimidin-7-yl) N-(3-cyano-5-fluorophenyl)carbamate (CID 155104341) is (5-chloro-3-cyclobutylpyrazolo[1,5-a]pyrimidin-7-yl) N-(3-cyano-5-fluorophenyl)carbamate.
What is the SMILES notation for (5-chloro-3-cyclobutylpyrazolo[1,5-a]pyrimidin-7-yl) N-(3-cyano-5-fluorophenyl)carbamate?
The canonical SMILES for (5-chloro-3-cyclobutylpyrazolo[1,5-a]pyrimidin-7-yl) N-(3-cyano-5-fluorophenyl)carbamate is N#Cc1cc(F)cc(NC(=O)Oc2cc(Cl)nc3c(C4CCC4)cnn23)c1.
What is the InChIKey of (5-chloro-3-cyclobutylpyrazolo[1,5-a]pyrimidin-7-yl) N-(3-cyano-5-fluorophenyl)carbamate?
The InChIKey is DJJFLBSEXGRVAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13ClFN5O2/c19-15-7-16(25-17(24-15)14(9-22-25)11-2-1-3-11)27-18(26)23-13-5-10(8-21)4-12(20)6-13/h4-7,9,11H,1-3H2,(H,23,26).
What are the key properties of (5-chloro-3-cyclobutylpyrazolo[1,5-a]pyrimidin-7-yl) N-(3-cyano-5-fluorophenyl)carbamate?
(5-chloro-3-cyclobutylpyrazolo[1,5-a]pyrimidin-7-yl) N-(3-cyano-5-fluorophenyl)carbamate has a molecular weight of 385.79 g/mol, XLogP of 4.27, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-3-cyclobutylpyrazolo[1,5-a]pyrimidin-7-yl) N-(3-cyano-5-fluorophenyl)carbamate is sourced from PubChem (CID 155104341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).