About 11-tert-butyl-7,8-difluorospiro[11H-benzo[c][1]benzothiepine-6,1'-cyclopropane]
11-tert-butyl-7,8-difluorospiro[11H-benzo[c][1]benzothiepine-6,1'-cyclopropane] (PubChem CID 155104772) has the molecular formula C20H20F2S
and a molecular weight of 330.44 g/mol. Its IUPAC name is 11-tert-butyl-7,8-difluorospiro[11H-benzo[c][1]benzothiepine-6,1'-cyclopropane].
Molecular Properties
| Compound Name | 11-tert-butyl-7,8-difluorospiro[11H-benzo[c][1]benzothiepine-6,1'-cyclopropane] |
| PubChem CID | 155104772 |
| Molecular Formula | C20H20F2S |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 11-tert-butyl-7,8-difluorospiro[11H-benzo[c][1]benzothiepine-6,1'-cyclopropane] |
| SMILES | CC(C)(C)C1c2ccccc2SC2(CC2)c2c1ccc(F)c2F |
| InChI | InChI=1S/C20H20F2S/c1-19(2,3)16-12-6-4-5-7-15(12)23-20(10-11-20)17-13(16)8-9-14(21)18(17)22/h4-9,16H,10-11H2,1-3H3 |
| InChIKey | FBMMXVYWCHJFNF-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 11-tert-butyl-7,8-difluorospiro[11H-benzo[c][1]benzothiepine-6,1'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-tert-butyl-7,8-difluorospiro[11H-benzo[c][1]benzothiepine-6,1'-cyclopropane]?
The IUPAC name of 11-tert-butyl-7,8-difluorospiro[11H-benzo[c][1]benzothiepine-6,1'-cyclopropane] (CID 155104772) is 11-tert-butyl-7,8-difluorospiro[11H-benzo[c][1]benzothiepine-6,1'-cyclopropane].
What is the SMILES notation for 11-tert-butyl-7,8-difluorospiro[11H-benzo[c][1]benzothiepine-6,1'-cyclopropane]?
The canonical SMILES for 11-tert-butyl-7,8-difluorospiro[11H-benzo[c][1]benzothiepine-6,1'-cyclopropane] is CC(C)(C)C1c2ccccc2SC2(CC2)c2c1ccc(F)c2F.
What is the InChIKey of 11-tert-butyl-7,8-difluorospiro[11H-benzo[c][1]benzothiepine-6,1'-cyclopropane]?
The InChIKey is FBMMXVYWCHJFNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20F2S/c1-19(2,3)16-12-6-4-5-7-15(12)23-20(10-11-20)17-13(16)8-9-14(21)18(17)22/h4-9,16H,10-11H2,1-3H3.
What are the key properties of 11-tert-butyl-7,8-difluorospiro[11H-benzo[c][1]benzothiepine-6,1'-cyclopropane]?
11-tert-butyl-7,8-difluorospiro[11H-benzo[c][1]benzothiepine-6,1'-cyclopropane] has a molecular weight of 330.44 g/mol, XLogP of 6.24, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 11-tert-butyl-7,8-difluorospiro[11H-benzo[c][1]benzothiepine-6,1'-cyclopropane] is sourced from PubChem (CID 155104772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).