About 7-hydroxy-1,4-dimethyl-5,6-diphenylbicyclo[2.2.1]hept-5-ene-2-carbaldehyde
7-hydroxy-1,4-dimethyl-5,6-diphenylbicyclo[2.2.1]hept-5-ene-2-carbaldehyde (PubChem CID 155105595) has the molecular formula C22H22O2
and a molecular weight of 318.42 g/mol. Its IUPAC name is 7-hydroxy-1,4-dimethyl-5,6-diphenylbicyclo[2.2.1]hept-5-ene-2-carbaldehyde.
Molecular Properties
| Compound Name | 7-hydroxy-1,4-dimethyl-5,6-diphenylbicyclo[2.2.1]hept-5-ene-2-carbaldehyde |
| PubChem CID | 155105595 |
| Molecular Formula | C22H22O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 7-hydroxy-1,4-dimethyl-5,6-diphenylbicyclo[2.2.1]hept-5-ene-2-carbaldehyde |
| SMILES | CC12CC(C=O)C(C)(C(c3ccccc3)=C1c1ccccc1)C2O |
| InChI | InChI=1S/C22H22O2/c1-21-13-17(14-23)22(2,20(21)24)19(16-11-7-4-8-12-16)18(21)15-9-5-3-6-10-15/h3-12,14,17,20,24H,13H2,1-2H3 |
| InChIKey | WXJQFUPPGLILDW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxy-1,4-dimethyl-5,6-diphenylbicyclo[2.2.1]hept-5-ene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-1,4-dimethyl-5,6-diphenylbicyclo[2.2.1]hept-5-ene-2-carbaldehyde?
The IUPAC name of 7-hydroxy-1,4-dimethyl-5,6-diphenylbicyclo[2.2.1]hept-5-ene-2-carbaldehyde (CID 155105595) is 7-hydroxy-1,4-dimethyl-5,6-diphenylbicyclo[2.2.1]hept-5-ene-2-carbaldehyde.
What is the SMILES notation for 7-hydroxy-1,4-dimethyl-5,6-diphenylbicyclo[2.2.1]hept-5-ene-2-carbaldehyde?
The canonical SMILES for 7-hydroxy-1,4-dimethyl-5,6-diphenylbicyclo[2.2.1]hept-5-ene-2-carbaldehyde is CC12CC(C=O)C(C)(C(c3ccccc3)=C1c1ccccc1)C2O.
What is the InChIKey of 7-hydroxy-1,4-dimethyl-5,6-diphenylbicyclo[2.2.1]hept-5-ene-2-carbaldehyde?
The InChIKey is WXJQFUPPGLILDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22O2/c1-21-13-17(14-23)22(2,20(21)24)19(16-11-7-4-8-12-16)18(21)15-9-5-3-6-10-15/h3-12,14,17,20,24H,13H2,1-2H3.
What are the key properties of 7-hydroxy-1,4-dimethyl-5,6-diphenylbicyclo[2.2.1]hept-5-ene-2-carbaldehyde?
7-hydroxy-1,4-dimethyl-5,6-diphenylbicyclo[2.2.1]hept-5-ene-2-carbaldehyde has a molecular weight of 318.42 g/mol, XLogP of 4.20, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-1,4-dimethyl-5,6-diphenylbicyclo[2.2.1]hept-5-ene-2-carbaldehyde is sourced from PubChem (CID 155105595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).