C27H43N3 — CID 155106119
(1Z)-1-[3-ethenylimino-5,5-dimethyl-6-[(2Z,4E,6E,8S)-8-methyltetradeca-2,4,6-trien-4-yl]-4H-pyridin-2-ylidene]-N-methylethanamine (PubChem CID 155106119) has the molecular formula C27H43N3 and a molecular weight of 409.66 g/mol. Its IUPAC name is (1Z)-1-[3-ethenylimino-5,5-dimethyl-6-[(2Z,4E,6E,8S)-8-methyltetradeca-2,4,6-trien-4-yl]-4H-pyridin-2-ylidene]-N-methylethanamine.
| Compound Name | (1Z)-1-[3-ethenylimino-5,5-dimethyl-6-[(2Z,4E,6E,8S)-8-methyltetradeca-2,4,6-trien-4-yl]-4H-pyridin-2-ylidene]-N-methylethanamine |
|---|---|
| PubChem CID | 155106119 |
| Molecular Formula | C27H43N3 |
| Molecular Weight | 409.66 g/mol |
| Exact Mass | 409.35 |
| IUPAC Name | (1Z)-1-[3-ethenylimino-5,5-dimethyl-6-[(2Z,4E,6E,8S)-8-methyltetradeca-2,4,6-trien-4-yl]-4H-pyridin-2-ylidene]-N-methylethanamine |
| SMILES | C=C/N=C1\CC(C)(C)C(C(/C=C\C)=C/C=C/[C@@H](C)CCCCCC)=N\C1=C(\C)NC |
| InChI | InChI=1S/C27H43N3/c1-9-12-13-14-17-21(4)18-15-19-23(16-10-2)26-27(6,7)20-24(29-11-3)25(30-26)22(5)28-8/h10-11,15-16,18-19,21,28H,3,9,12-14,17,20H2,1-2,4-8H3/b16-10-,18-15+,23-19+,25-22-,29-24+/t21-/m0/s1 |
| InChIKey | PCPXCJJPPGYWPF-VTKPMQIMSA-N |
| XLogP | 7.56 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.66 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|