C20H32N2 — CID 155106203
(5E,7E)-8-cyclohexyl-5-ethenyl-1-N,4-N,3,3-tetramethylocta-5,7-diene-1,4-diimine (PubChem CID 155106203) has the molecular formula C20H32N2 and a molecular weight of 300.49 g/mol. Its IUPAC name is (5E,7E)-8-cyclohexyl-5-ethenyl-1-N,4-N,3,3-tetramethylocta-5,7-diene-1,4-diimine.
| Compound Name | (5E,7E)-8-cyclohexyl-5-ethenyl-1-N,4-N,3,3-tetramethylocta-5,7-diene-1,4-diimine |
|---|---|
| PubChem CID | 155106203 |
| Molecular Formula | C20H32N2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.26 |
| IUPAC Name | (5E,7E)-8-cyclohexyl-5-ethenyl-1-N,4-N,3,3-tetramethylocta-5,7-diene-1,4-diimine |
| SMILES | C=CC(=C\C=C\C1CCCCC1)/C(=N/C)C(C)(C)C/C=N/C |
| InChI | InChI=1S/C20H32N2/c1-6-18(14-10-13-17-11-8-7-9-12-17)19(22-5)20(2,3)15-16-21-4/h6,10,13-14,16-17H,1,7-9,11-12,15H2,2-5H3/b13-10+,18-14+,21-16+,22-19- |
| InChIKey | PWRCSVXSEPJUNK-QKKSPZOVSA-N |
| XLogP | 5.42 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|