C12H13FO2S2 — CID 155106307
1-(5-fluoro-2-methoxyphenyl)-3,3-bis(methylsulfanyl)prop-2-en-1-one (PubChem CID 155106307) has the molecular formula C12H13FO2S2 and a molecular weight of 272.37 g/mol. Its IUPAC name is 1-(5-fluoro-2-methoxyphenyl)-3,3-bis(methylsulfanyl)prop-2-en-1-one.
| Compound Name | 1-(5-fluoro-2-methoxyphenyl)-3,3-bis(methylsulfanyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 155106307 |
| Molecular Formula | C12H13FO2S2 |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 1-(5-fluoro-2-methoxyphenyl)-3,3-bis(methylsulfanyl)prop-2-en-1-one |
| SMILES | COc1ccc(F)cc1C(=O)C=C(SC)SC |
| InChI | InChI=1S/C12H13FO2S2/c1-15-11-5-4-8(13)6-9(11)10(14)7-12(16-2)17-3/h4-7H,1-3H3 |
| InChIKey | AUEHZKIVAVBGSV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|