C52H43N3 — CID 155106316
(4Z,6E)-5-[N-[1-(4-naphthalen-1-ylphenyl)ethenyl]-C-phenylcarbonimidoyl]-7-(9-phenylcarbazol-3-yl)nona-1,4,6-trien-4-amine (PubChem CID 155106316) has the molecular formula C52H43N3 and a molecular weight of 709.94 g/mol. Its IUPAC name is (4Z,6E)-5-[N-[1-(4-naphthalen-1-ylphenyl)ethenyl]-C-phenylcarbonimidoyl]-7-(9-phenylcarbazol-3-yl)nona-1,4,6-trien-4-amine.
| Compound Name | (4Z,6E)-5-[N-[1-(4-naphthalen-1-ylphenyl)ethenyl]-C-phenylcarbonimidoyl]-7-(9-phenylcarbazol-3-yl)nona-1,4,6-trien-4-amine |
|---|---|
| PubChem CID | 155106316 |
| Molecular Formula | C52H43N3 |
| Molecular Weight | 709.94 g/mol |
| Exact Mass | 709.35 |
| IUPAC Name | (4Z,6E)-5-[N-[1-(4-naphthalen-1-ylphenyl)ethenyl]-C-phenylcarbonimidoyl]-7-(9-phenylcarbazol-3-yl)nona-1,4,6-trien-4-amine |
| SMILES | C=CC/C(N)=C(\C=C(/CC)c1ccc2c(c1)c1ccccc1n2-c1ccccc1)C(=N/C(=C)c1ccc(-c2cccc3ccccc23)cc1)/c1ccccc1 |
| InChI | InChI=1S/C52H43N3/c1-4-17-49(53)48(34-37(5-2)42-32-33-51-47(35-42)46-25-14-15-27-50(46)55(51)43-22-10-7-11-23-43)52(41-19-8-6-9-20-41)54-36(3)38-28-30-40(31-29-38)45-26-16-21-39-18-12-13-24-44(39)45/h4,6-16,18-35H,1,3,5,17,53H2,2H3/b37-34+,49-48-,54-52+ |
| InChIKey | IDCJKAVYTZBAMM-HNZBQAFRSA-N |
| XLogP | 13.35 |
| TPSA | 43.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.94 |
| LogP ≤ 5 | 13.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|