C22H24N4O4 — CID 155106502
N-[[4-[5-amino-4-formyl-1-(1-hydroxypropan-2-yl)pyrazol-3-yl]phenyl]methyl]-2-methoxybenzamide (PubChem CID 155106502) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is N-[[4-[5-amino-4-formyl-1-(1-hydroxypropan-2-yl)pyrazol-3-yl]phenyl]methyl]-2-methoxybenzamide.
| Compound Name | N-[[4-[5-amino-4-formyl-1-(1-hydroxypropan-2-yl)pyrazol-3-yl]phenyl]methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 155106502 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N-[[4-[5-amino-4-formyl-1-(1-hydroxypropan-2-yl)pyrazol-3-yl]phenyl]methyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NCc1ccc(-c2nn(C(C)CO)c(N)c2C=O)cc1 |
| InChI | InChI=1S/C22H24N4O4/c1-14(12-27)26-21(23)18(13-28)20(25-26)16-9-7-15(8-10-16)11-24-22(29)17-5-3-4-6-19(17)30-2/h3-10,13-14,27H,11-12,23H2,1-2H3,(H,24,29) |
| InChIKey | PBFWVECVYPAMEZ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|