C6H9N3O3 — CID 155106929
3,5-dimethyl-1,3,5-triazepane-2,4,6-trione (PubChem CID 155106929) has the molecular formula C6H9N3O3 and a molecular weight of 171.16 g/mol. Its IUPAC name is 3,5-dimethyl-1,3,5-triazepane-2,4,6-trione.
| Compound Name | 3,5-dimethyl-1,3,5-triazepane-2,4,6-trione |
|---|---|
| PubChem CID | 155106929 |
| Molecular Formula | C6H9N3O3 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 3,5-dimethyl-1,3,5-triazepane-2,4,6-trione |
| SMILES | CN1C(=O)CNC(=O)N(C)C1=O |
| InChI | InChI=1S/C6H9N3O3/c1-8-4(10)3-7-5(11)9(2)6(8)12/h3H2,1-2H3,(H,7,11) |
| InChIKey | CADYWOBUXHYBPR-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |