C11H15F3N4S2 — CID 155107416
5-(methylideneamino)-N-(2-methylsulfanylethyl)-2-(3,3,3-trifluoropropylsulfanyl)pyrimidin-4-amine (PubChem CID 155107416) has the molecular formula C11H15F3N4S2 and a molecular weight of 324.40 g/mol. Its IUPAC name is 5-(methylideneamino)-N-(2-methylsulfanylethyl)-2-(3,3,3-trifluoropropylsulfanyl)pyrimidin-4-amine.
| Compound Name | 5-(methylideneamino)-N-(2-methylsulfanylethyl)-2-(3,3,3-trifluoropropylsulfanyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 155107416 |
| Molecular Formula | C11H15F3N4S2 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 5-(methylideneamino)-N-(2-methylsulfanylethyl)-2-(3,3,3-trifluoropropylsulfanyl)pyrimidin-4-amine |
| SMILES | C=Nc1cnc(SCCC(F)(F)F)nc1NCCSC |
| InChI | InChI=1S/C11H15F3N4S2/c1-15-8-7-17-10(20-5-3-11(12,13)14)18-9(8)16-4-6-19-2/h7H,1,3-6H2,2H3,(H,16,17,18) |
| InChIKey | VMQMPCDSIVFGFB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|