C14H21NO — CID 155107795
(3R)-4-[(3Z,5Z)-6-methylocta-1,3,5,7-tetraen-2-yl]piperidin-3-ol (PubChem CID 155107795) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is (3R)-4-[(3Z,5Z)-6-methylocta-1,3,5,7-tetraen-2-yl]piperidin-3-ol.
| Compound Name | (3R)-4-[(3Z,5Z)-6-methylocta-1,3,5,7-tetraen-2-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 155107795 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | (3R)-4-[(3Z,5Z)-6-methylocta-1,3,5,7-tetraen-2-yl]piperidin-3-ol |
| SMILES | C=C/C(C)=C\C=C/C(=C)C1CCNC[C@@H]1O |
| InChI | InChI=1S/C14H21NO/c1-4-11(2)6-5-7-12(3)13-8-9-15-10-14(13)16/h4-7,13-16H,1,3,8-10H2,2H3/b7-5-,11-6-/t13?,14-/m0/s1 |
| InChIKey | BAMZODZLLHWAPM-YKVCSXQTSA-N |
| XLogP | 2.20 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|