C32H59OP — CID 155107855
[(14Z,17Z)-1-[butyl(methyl)phosphoryl]-6-methylidenetricosa-14,17-dien-3-yl]cyclopropane (PubChem CID 155107855) has the molecular formula C32H59OP and a molecular weight of 490.80 g/mol. Its IUPAC name is [(14Z,17Z)-1-[butyl(methyl)phosphoryl]-6-methylidenetricosa-14,17-dien-3-yl]cyclopropane.
| Compound Name | [(14Z,17Z)-1-[butyl(methyl)phosphoryl]-6-methylidenetricosa-14,17-dien-3-yl]cyclopropane |
|---|---|
| PubChem CID | 155107855 |
| Molecular Formula | C32H59OP |
| Molecular Weight | 490.80 g/mol |
| Exact Mass | 490.43 |
| IUPAC Name | [(14Z,17Z)-1-[butyl(methyl)phosphoryl]-6-methylidenetricosa-14,17-dien-3-yl]cyclopropane |
| SMILES | C=C(CCCCCCC/C=C\C/C=C\CCCCC)CCC(CCP(C)(=O)CCCC)C1CC1 |
| InChI | InChI=1S/C32H59OP/c1-5-7-9-10-11-12-13-14-15-16-17-18-19-20-21-22-30(3)23-24-32(31-25-26-31)27-29-34(4,33)28-8-6-2/h11-12,14-15,31-32H,3,5-10,13,16-29H2,1-2,4H3/b12-11-,15-14- |
| InChIKey | YHXQVHVHHAKPLH-HDXUUTQWSA-N |
| XLogP | 11.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.80 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|