C34H34N4O2 — CID 15510787
5-(3,5-dimethoxyphenyl)-13,17-diethyl-12,18-dimethyl-21,22-dihydroporphyrin (PubChem CID 15510787) has the molecular formula C34H34N4O2 and a molecular weight of 530.67 g/mol. Its IUPAC name is 5-(3,5-dimethoxyphenyl)-13,17-diethyl-12,18-dimethyl-21,22-dihydroporphyrin.
| Compound Name | 5-(3,5-dimethoxyphenyl)-13,17-diethyl-12,18-dimethyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 15510787 |
| Molecular Formula | C34H34N4O2 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | 5-(3,5-dimethoxyphenyl)-13,17-diethyl-12,18-dimethyl-21,22-dihydroporphyrin |
| SMILES | CCC1=C(C)c2cc3ccc([nH]3)c(-c3cc(OC)cc(OC)c3)c3ccc(cc4nc(cc1n2)C(CC)=C4C)[nH]3 |
| InChI | InChI=1S/C34H34N4O2/c1-7-26-19(3)30-15-22-9-11-28(35-22)34(21-13-24(39-5)17-25(14-21)40-6)29-12-10-23(36-29)16-31-20(4)27(8-2)33(38-31)18-32(26)37-30/h9-18,35-36H,7-8H2,1-6H3/b22-15-,23-16-,30-15-,31-16-,32-18-,33-18-,34-28-,34-29- |
| InChIKey | FXYKOWDWEMKCAT-YRZSTELJSA-N |
| XLogP | 8.68 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |