C31H35Cl2N7O3 — CID 155108501
1-[4-[3-[12-(cyclopropylmethylamino)-7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]propyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 155108501) has the molecular formula C31H35Cl2N7O3 and a molecular weight of 624.57 g/mol. Its IUPAC name is 1-[4-[3-[12-(cyclopropylmethylamino)-7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]propyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[3-[12-(cyclopropylmethylamino)-7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]propyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155108501 |
| Molecular Formula | C31H35Cl2N7O3 |
| Molecular Weight | 624.57 g/mol |
| Exact Mass | 623.22 |
| IUPAC Name | 1-[4-[3-[12-(cyclopropylmethylamino)-7-(2,6-dichloro-3,5-dimethoxyphenyl)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]propyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(CCCc2cn3c(n2)c(-c2c(Cl)c(OC)cc(OC)c2Cl)cc2cnc(NCC4CC4)nc23)CC1 |
| InChI | InChI=1S/C31H35Cl2N7O3/c1-4-25(41)39-12-10-38(11-13-39)9-5-6-21-18-40-29-20(17-35-31(37-29)34-16-19-7-8-19)14-22(30(40)36-21)26-27(32)23(42-2)15-24(43-3)28(26)33/h4,14-15,17-19H,1,5-13,16H2,2-3H3,(H,34,35,37) |
| InChIKey | FHTVMOGYYMPWCM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|