C30H35Cl2N7O4 — CID 155108505
1-[4-[3-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-12-(2-methoxyethylamino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]propyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 155108505) has the molecular formula C30H35Cl2N7O4 and a molecular weight of 628.56 g/mol. Its IUPAC name is 1-[4-[3-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-12-(2-methoxyethylamino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]propyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[3-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-12-(2-methoxyethylamino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]propyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155108505 |
| Molecular Formula | C30H35Cl2N7O4 |
| Molecular Weight | 628.56 g/mol |
| Exact Mass | 627.21 |
| IUPAC Name | 1-[4-[3-[7-(2,6-dichloro-3,5-dimethoxyphenyl)-12-(2-methoxyethylamino)-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-4-yl]propyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(CCCc2cn3c(n2)c(-c2c(Cl)c(OC)cc(OC)c2Cl)cc2cnc(NCCOC)nc23)CC1 |
| InChI | InChI=1S/C30H35Cl2N7O4/c1-5-24(40)38-12-10-37(11-13-38)9-6-7-20-18-39-28-19(17-34-30(36-28)33-8-14-41-2)15-21(29(39)35-20)25-26(31)22(42-3)16-23(43-4)27(25)32/h5,15-18H,1,6-14H2,2-4H3,(H,33,34,36) |
| InChIKey | HDQIPSJMWYHVND-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|