C21H23N9O — CID 155108953
5-[(5-cyano-1H-pyrrolo[2,3-b]pyridin-4-yl)-methylamino]-N-(1-ethyl-1,2,4-triazol-3-yl)-3,5,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxamide (PubChem CID 155108953) has the molecular formula C21H23N9O and a molecular weight of 417.48 g/mol. Its IUPAC name is 5-[(5-cyano-1H-pyrrolo[2,3-b]pyridin-4-yl)-methylamino]-N-(1-ethyl-1,2,4-triazol-3-yl)-3,5,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxamide.
| Compound Name | 5-[(5-cyano-1H-pyrrolo[2,3-b]pyridin-4-yl)-methylamino]-N-(1-ethyl-1,2,4-triazol-3-yl)-3,5,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 155108953 |
| Molecular Formula | C21H23N9O |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 5-[(5-cyano-1H-pyrrolo[2,3-b]pyridin-4-yl)-methylamino]-N-(1-ethyl-1,2,4-triazol-3-yl)-3,5,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
| SMILES | CCn1cnc(NC(=O)N2CC3=CC(N(C)c4c(C#N)cnc5[nH]ccc45)CC3C2)n1 |
| InChI | InChI=1S/C21H23N9O/c1-3-30-12-25-20(27-30)26-21(31)29-10-13-6-16(7-14(13)11-29)28(2)18-15(8-22)9-24-19-17(18)4-5-23-19/h4-6,9,12,14,16H,3,7,10-11H2,1-2H3,(H,23,24)(H,26,27,31) |
| InChIKey | MXWDQWBASAFQJC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 118.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|