C20H26F3N3O — CID 155109547
N-[4-[[(2E,3Z)-2,3-bis(prop-2-enylidene)-4-pyridinyl]amino]-2,4-dimethylpentan-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 155109547) has the molecular formula C20H26F3N3O and a molecular weight of 381.44 g/mol. Its IUPAC name is N-[4-[[(2E,3Z)-2,3-bis(prop-2-enylidene)-4-pyridinyl]amino]-2,4-dimethylpentan-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-[[(2E,3Z)-2,3-bis(prop-2-enylidene)-4-pyridinyl]amino]-2,4-dimethylpentan-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 155109547 |
| Molecular Formula | C20H26F3N3O |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | N-[4-[[(2E,3Z)-2,3-bis(prop-2-enylidene)-4-pyridinyl]amino]-2,4-dimethylpentan-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | C=C/C=c1/c(NC(C)(C)CC(C)(C)NC(=O)C(F)(F)F)ccn/c1=C/C=C |
| InChI | InChI=1S/C20H26F3N3O/c1-7-9-14-15(10-8-2)24-12-11-16(14)25-18(3,4)13-19(5,6)26-17(27)20(21,22)23/h7-12,25H,1-2,13H2,3-6H3,(H,26,27)/b14-9+,15-10+ |
| InChIKey | OHNMRRUIUJMKLU-AOEKMSOUSA-N |
| XLogP | 3.05 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |