C26H27N3O4S — CID 155109694
2-[hydroxy-[[4-(3-pyrrolidin-1-ylphenyl)sulfonylphenyl]methylamino]methyl]-1H-indol-5-ol (PubChem CID 155109694) has the molecular formula C26H27N3O4S and a molecular weight of 477.59 g/mol. Its IUPAC name is 2-[hydroxy-[[4-(3-pyrrolidin-1-ylphenyl)sulfonylphenyl]methylamino]methyl]-1H-indol-5-ol.
| Compound Name | 2-[hydroxy-[[4-(3-pyrrolidin-1-ylphenyl)sulfonylphenyl]methylamino]methyl]-1H-indol-5-ol |
|---|---|
| PubChem CID | 155109694 |
| Molecular Formula | C26H27N3O4S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 2-[hydroxy-[[4-(3-pyrrolidin-1-ylphenyl)sulfonylphenyl]methylamino]methyl]-1H-indol-5-ol |
| SMILES | O=S(=O)(c1ccc(CNC(O)c2cc3cc(O)ccc3[nH]2)cc1)c1cccc(N2CCCC2)c1 |
| InChI | InChI=1S/C26H27N3O4S/c30-21-8-11-24-19(14-21)15-25(28-24)26(31)27-17-18-6-9-22(10-7-18)34(32,33)23-5-3-4-20(16-23)29-12-1-2-13-29/h3-11,14-16,26-28,30-31H,1-2,12-13,17H2 |
| InChIKey | YEGXSYFRHFGSFL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 105.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|