C23H23F3N6O2 — CID 155110679
3-fluoro-N-[(2R,3R)-3-fluoro-1-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-4-methoxybutan-2-yl]-2-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]benzamide (PubChem CID 155110679) has the molecular formula C23H23F3N6O2 and a molecular weight of 472.47 g/mol. Its IUPAC name is 3-fluoro-N-[(2R,3R)-3-fluoro-1-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-4-methoxybutan-2-yl]-2-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]benzamide.
| Compound Name | 3-fluoro-N-[(2R,3R)-3-fluoro-1-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-4-methoxybutan-2-yl]-2-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]benzamide |
|---|---|
| PubChem CID | 155110679 |
| Molecular Formula | C23H23F3N6O2 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 3-fluoro-N-[(2R,3R)-3-fluoro-1-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-4-methoxybutan-2-yl]-2-[3-(4-fluorophenyl)-1H-pyrazol-5-yl]benzamide |
| SMILES | [H]/N=C/C=N\NC[C@@H](NC(=O)c1cccc(F)c1-c1cc(-c2ccc(F)cc2)n[nH]1)[C@@H](F)COC |
| InChI | InChI=1S/C23H23F3N6O2/c1-34-13-18(26)21(12-29-28-10-9-27)30-23(33)16-3-2-4-17(25)22(16)20-11-19(31-32-20)14-5-7-15(24)8-6-14/h2-11,18,21,27,29H,12-13H2,1H3,(H,30,33)(H,31,32)/b27-9+,28-10-/t18-,21+/m0/s1 |
| InChIKey | ZBBYVSNIPJUHSO-YRLUMMPPSA-N |
| XLogP | 3.33 |
| TPSA | 115.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|