C11H17N3O4 — CID 155110911
1-tert-butyl-3-methyl-5-(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 155110911) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is 1-tert-butyl-3-methyl-5-(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-tert-butyl-3-methyl-5-(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 155110911 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 1-tert-butyl-3-methyl-5-(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | Cn1c(=O)n(CC2CO2)c(=O)n(C(C)(C)C)c1=O |
| InChI | InChI=1S/C11H17N3O4/c1-11(2,3)14-9(16)12(4)8(15)13(10(14)17)5-7-6-18-7/h7H,5-6H2,1-4H3 |
| InChIKey | PSNFUOFCSFNWOP-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 78.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|