C33H55N3 — CID 155111176
(3Z,5E,8Z)-N-[(1Z)-1-[4-[2-(dipropylamino)ethyl]piperidin-1-yl]-2-methylbuta-1,3-dienyl]-9-ethyl-2-methyl-7-methylideneundeca-3,5,8,10-tetraen-5-amine (PubChem CID 155111176) has the molecular formula C33H55N3 and a molecular weight of 493.82 g/mol. Its IUPAC name is (3Z,5E,8Z)-N-[(1Z)-1-[4-[2-(dipropylamino)ethyl]piperidin-1-yl]-2-methylbuta-1,3-dienyl]-9-ethyl-2-methyl-7-methylideneundeca-3,5,8,10-tetraen-5-amine.
| Compound Name | (3Z,5E,8Z)-N-[(1Z)-1-[4-[2-(dipropylamino)ethyl]piperidin-1-yl]-2-methylbuta-1,3-dienyl]-9-ethyl-2-methyl-7-methylideneundeca-3,5,8,10-tetraen-5-amine |
|---|---|
| PubChem CID | 155111176 |
| Molecular Formula | C33H55N3 |
| Molecular Weight | 493.82 g/mol |
| Exact Mass | 493.44 |
| IUPAC Name | (3Z,5E,8Z)-N-[(1Z)-1-[4-[2-(dipropylamino)ethyl]piperidin-1-yl]-2-methylbuta-1,3-dienyl]-9-ethyl-2-methyl-7-methylideneundeca-3,5,8,10-tetraen-5-amine |
| SMILES | C=C/C(=C\C(=C)/C=C(/C=C\C(C)C)N/C(=C(\C)C=C)N1CCC(CCN(CCC)CCC)CC1)CC |
| InChI | InChI=1S/C33H55N3/c1-10-20-35(21-11-2)22-17-31-18-23-36(24-19-31)33(29(9)12-3)34-32(16-15-27(6)7)26-28(8)25-30(13-4)14-5/h12-13,15-16,25-27,31,34H,3-4,8,10-11,14,17-24H2,1-2,5-7,9H3/b16-15-,30-25+,32-26+,33-29- |
| InChIKey | QHKHGZOELNCRAM-KXHRGVHSSA-N |
| XLogP | 8.39 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.82 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|