C11H18O — CID 15511119
(2E,5E)-5,6,7-trimethylocta-2,5-dien-4-one (PubChem CID 15511119) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (2E,5E)-5,6,7-trimethylocta-2,5-dien-4-one.
| Compound Name | (2E,5E)-5,6,7-trimethylocta-2,5-dien-4-one |
|---|---|
| PubChem CID | 15511119 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (2E,5E)-5,6,7-trimethylocta-2,5-dien-4-one |
| SMILES | C/C=C/C(=O)/C(C)=C(\C)C(C)C |
| InChI | InChI=1S/C11H18O/c1-6-7-11(12)10(5)9(4)8(2)3/h6-8H,1-5H3/b7-6+,10-9+ |
| InChIKey | QWRGOHMKGNCVAC-AVQMFFATSA-N |
| XLogP | 3.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|