C6H13FN2 — CID 155111196
(3S,5S)-3-fluoro-5-methylpiperidin-1-amine (PubChem CID 155111196) has the molecular formula C6H13FN2 and a molecular weight of 132.18 g/mol. Its IUPAC name is (3S,5S)-3-fluoro-5-methylpiperidin-1-amine.
| Compound Name | (3S,5S)-3-fluoro-5-methylpiperidin-1-amine |
|---|---|
| PubChem CID | 155111196 |
| Molecular Formula | C6H13FN2 |
| Molecular Weight | 132.18 g/mol |
| Exact Mass | 132.11 |
| IUPAC Name | (3S,5S)-3-fluoro-5-methylpiperidin-1-amine |
| SMILES | C[C@H]1C[C@H](F)CN(N)C1 |
| InChI | InChI=1S/C6H13FN2/c1-5-2-6(7)4-9(8)3-5/h5-6H,2-4,8H2,1H3/t5-,6-/m0/s1 |
| InChIKey | ALWJPGAAVDWFDI-WDSKDSINSA-N |
| XLogP | 0.54 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.18 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|