C23H35N — CID 155111382
(6Z)-4-(4-tert-butylphenyl)-1-ethyl-6-ethylidene-N,5,5-trimethylcyclohex-3-en-1-amine (PubChem CID 155111382) has the molecular formula C23H35N and a molecular weight of 325.54 g/mol. Its IUPAC name is (6Z)-4-(4-tert-butylphenyl)-1-ethyl-6-ethylidene-N,5,5-trimethylcyclohex-3-en-1-amine.
| Compound Name | (6Z)-4-(4-tert-butylphenyl)-1-ethyl-6-ethylidene-N,5,5-trimethylcyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 155111382 |
| Molecular Formula | C23H35N |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.28 |
| IUPAC Name | (6Z)-4-(4-tert-butylphenyl)-1-ethyl-6-ethylidene-N,5,5-trimethylcyclohex-3-en-1-amine |
| SMILES | C/C=C1\C(CC)(NC)CC=C(c2ccc(C(C)(C)C)cc2)C1(C)C |
| InChI | InChI=1S/C23H35N/c1-9-20-22(6,7)19(15-16-23(20,10-2)24-8)17-11-13-18(14-12-17)21(3,4)5/h9,11-15,24H,10,16H2,1-8H3/b20-9- |
| InChIKey | DUOMRZVFKJKHQR-UKWGHVSLSA-N |
| XLogP | 6.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|