C24H27F2N5O2 — CID 155111629
1-[[3-(difluoromethoxy)phenyl]methyl]-3-[4-[(3Z)-3-hydrazinylideneprop-1-en-2-yl]phenyl]-1,3,8-triazaspiro[4.5]decan-2-one (PubChem CID 155111629) has the molecular formula C24H27F2N5O2 and a molecular weight of 455.51 g/mol. Its IUPAC name is 1-[[3-(difluoromethoxy)phenyl]methyl]-3-[4-[(3Z)-3-hydrazinylideneprop-1-en-2-yl]phenyl]-1,3,8-triazaspiro[4.5]decan-2-one.
| Compound Name | 1-[[3-(difluoromethoxy)phenyl]methyl]-3-[4-[(3Z)-3-hydrazinylideneprop-1-en-2-yl]phenyl]-1,3,8-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 155111629 |
| Molecular Formula | C24H27F2N5O2 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 1-[[3-(difluoromethoxy)phenyl]methyl]-3-[4-[(3Z)-3-hydrazinylideneprop-1-en-2-yl]phenyl]-1,3,8-triazaspiro[4.5]decan-2-one |
| SMILES | C=C(/C=N\N)c1ccc(N2CC3(CCNCC3)N(Cc3cccc(OC(F)F)c3)C2=O)cc1 |
| InChI | InChI=1S/C24H27F2N5O2/c1-17(14-29-27)19-5-7-20(8-6-19)30-16-24(9-11-28-12-10-24)31(23(30)32)15-18-3-2-4-21(13-18)33-22(25)26/h2-8,13-14,22,28H,1,9-12,15-16,27H2/b29-14- |
| InChIKey | IDDVNYNUOKXIDG-NUJZUDFISA-N |
| XLogP | 3.81 |
| TPSA | 83.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|