C20H31N3O — CID 155112261
5-ethyl-2-methyl-4-[[(7E,9Z)-7-methyldodeca-7,9,11-trien-3-yl]amino]-1H-pyrimidin-6-one (PubChem CID 155112261) has the molecular formula C20H31N3O and a molecular weight of 329.49 g/mol. Its IUPAC name is 5-ethyl-2-methyl-4-[[(7E,9Z)-7-methyldodeca-7,9,11-trien-3-yl]amino]-1H-pyrimidin-6-one.
| Compound Name | 5-ethyl-2-methyl-4-[[(7E,9Z)-7-methyldodeca-7,9,11-trien-3-yl]amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 155112261 |
| Molecular Formula | C20H31N3O |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | 5-ethyl-2-methyl-4-[[(7E,9Z)-7-methyldodeca-7,9,11-trien-3-yl]amino]-1H-pyrimidin-6-one |
| SMILES | C=C/C=C\C=C(/C)CCCC(CC)Nc1nc(C)[nH]c(=O)c1CC |
| InChI | InChI=1S/C20H31N3O/c1-6-9-10-12-15(4)13-11-14-17(7-2)23-19-18(8-3)20(24)22-16(5)21-19/h6,9-10,12,17H,1,7-8,11,13-14H2,2-5H3,(H2,21,22,23,24)/b10-9-,15-12+ |
| InChIKey | IIHUTRJPZIWJOI-IFBDVHKASA-N |
| XLogP | 4.69 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|