C19H24F6N4O — CID 155112295
5-amino-1-[(4E,6E)-4-ethenyl-8,8,8-trifluoro-2,2,7-trimethylocta-4,6-dien-3-yl]-3-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide (PubChem CID 155112295) has the molecular formula C19H24F6N4O and a molecular weight of 438.42 g/mol. Its IUPAC name is 5-amino-1-[(4E,6E)-4-ethenyl-8,8,8-trifluoro-2,2,7-trimethylocta-4,6-dien-3-yl]-3-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide.
| Compound Name | 5-amino-1-[(4E,6E)-4-ethenyl-8,8,8-trifluoro-2,2,7-trimethylocta-4,6-dien-3-yl]-3-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 155112295 |
| Molecular Formula | C19H24F6N4O |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 5-amino-1-[(4E,6E)-4-ethenyl-8,8,8-trifluoro-2,2,7-trimethylocta-4,6-dien-3-yl]-3-(2,2,2-trifluoroethyl)pyrazole-4-carboxamide |
| SMILES | C=C/C(=C\C=C(/C)C(F)(F)F)C(n1nc(CC(F)(F)F)c(C(N)=O)c1N)C(C)(C)C |
| InChI | InChI=1S/C19H24F6N4O/c1-6-11(8-7-10(2)19(23,24)25)14(17(3,4)5)29-15(26)13(16(27)30)12(28-29)9-18(20,21)22/h6-8,14H,1,9,26H2,2-5H3,(H2,27,30)/b10-7+,11-8+ |
| InChIKey | PYNHIUWOZZQXLX-AMMQDNIMSA-N |
| XLogP | 4.88 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|