C44H31O2P — CID 155112409
3'-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]-phenylphosphoryl]spiro[fluorene-9,7'-fluoreno[4,3-b][1]benzofuran] (PubChem CID 155112409) has the molecular formula C44H31O2P and a molecular weight of 622.70 g/mol. Its IUPAC name is 3'-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]-phenylphosphoryl]spiro[fluorene-9,7'-fluoreno[4,3-b][1]benzofuran].
| Compound Name | 3'-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]-phenylphosphoryl]spiro[fluorene-9,7'-fluoreno[4,3-b][1]benzofuran] |
|---|---|
| PubChem CID | 155112409 |
| Molecular Formula | C44H31O2P |
| Molecular Weight | 622.70 g/mol |
| Exact Mass | 622.21 |
| IUPAC Name | 3'-[[(3E,5Z)-hepta-1,3,5-trien-4-yl]-phenylphosphoryl]spiro[fluorene-9,7'-fluoreno[4,3-b][1]benzofuran] |
| SMILES | C=C/C=C(\C=C/C)P(=O)(c1ccccc1)c1ccc2oc3c4c(ccc3c2c1)C1(c2ccccc2-c2ccccc21)c1ccccc1-4 |
| InChI | InChI=1S/C44H31O2P/c1-3-14-29(15-4-2)47(45,30-16-6-5-7-17-30)31-24-27-41-36(28-31)34-25-26-40-42(43(34)46-41)35-20-10-13-23-39(35)44(40)37-21-11-8-18-32(37)33-19-9-12-22-38(33)44/h3-28H,1H2,2H3/b15-4-,29-14+ |
| InChIKey | ITBJJJWKMKEVHT-QJQCJMTFSA-N |
| XLogP | 10.89 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.70 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|