C15H20F4N2 — CID 155112575
(3E,6Z,7E)-6-ethylidene-1,1,1,8-tetrafluoro-N,N-dimethyl-2-methyliminodeca-3,7,9-trien-3-amine (PubChem CID 155112575) has the molecular formula C15H20F4N2 and a molecular weight of 304.33 g/mol. Its IUPAC name is (3E,6Z,7E)-6-ethylidene-1,1,1,8-tetrafluoro-N,N-dimethyl-2-methyliminodeca-3,7,9-trien-3-amine.
| Compound Name | (3E,6Z,7E)-6-ethylidene-1,1,1,8-tetrafluoro-N,N-dimethyl-2-methyliminodeca-3,7,9-trien-3-amine |
|---|---|
| PubChem CID | 155112575 |
| Molecular Formula | C15H20F4N2 |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (3E,6Z,7E)-6-ethylidene-1,1,1,8-tetrafluoro-N,N-dimethyl-2-methyliminodeca-3,7,9-trien-3-amine |
| SMILES | C=C/C(F)=C\C(=C/C)C/C=C(C(=N\C)\C(F)(F)F)/N(C)C |
| InChI | InChI=1S/C15H20F4N2/c1-6-11(10-12(16)7-2)8-9-13(21(4)5)14(20-3)15(17,18)19/h6-7,9-10H,2,8H2,1,3-5H3/b11-6-,12-10+,13-9+,20-14- |
| InChIKey | PYBGTZVYQWHUTF-VBALXOJQSA-N |
| XLogP | 4.44 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|