C30H37FN6O2S — CID 155112690
methyl 4-[2-ethyl-3-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-methylamino]imidazo[1,2-a]pyridin-6-yl]-N-(4-hydroxybutyl)piperidine-1-carboximidate (PubChem CID 155112690) has the molecular formula C30H37FN6O2S and a molecular weight of 564.73 g/mol. Its IUPAC name is methyl 4-[2-ethyl-3-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-methylamino]imidazo[1,2-a]pyridin-6-yl]-N-(4-hydroxybutyl)piperidine-1-carboximidate.
| Compound Name | methyl 4-[2-ethyl-3-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-methylamino]imidazo[1,2-a]pyridin-6-yl]-N-(4-hydroxybutyl)piperidine-1-carboximidate |
|---|---|
| PubChem CID | 155112690 |
| Molecular Formula | C30H37FN6O2S |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | methyl 4-[2-ethyl-3-[[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-methylamino]imidazo[1,2-a]pyridin-6-yl]-N-(4-hydroxybutyl)piperidine-1-carboximidate |
| SMILES | CCc1nc2ccc(C3CCN(/C(=N/CCCCO)OC)CC3)cn2c1N(C)c1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C30H37FN6O2S/c1-4-25-28(35(2)30-34-26(20-40-30)22-7-10-24(31)11-8-22)37-19-23(9-12-27(37)33-25)21-13-16-36(17-14-21)29(39-3)32-15-5-6-18-38/h7-12,19-21,38H,4-6,13-18H2,1-3H3/b32-29- |
| InChIKey | UOUVAWXKCCFLHI-OVXWJCGASA-N |
| XLogP | 5.88 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|