C25H19FN4OS — CID 155113935
1-[2-[(4-fluorophenyl)methylsulfanyl]-3H-benzimidazol-5-yl]-3-naphthalen-2-ylurea (PubChem CID 155113935) has the molecular formula C25H19FN4OS and a molecular weight of 442.52 g/mol. Its IUPAC name is 1-[2-[(4-fluorophenyl)methylsulfanyl]-3H-benzimidazol-5-yl]-3-naphthalen-2-ylurea.
| Compound Name | 1-[2-[(4-fluorophenyl)methylsulfanyl]-3H-benzimidazol-5-yl]-3-naphthalen-2-ylurea |
|---|---|
| PubChem CID | 155113935 |
| Molecular Formula | C25H19FN4OS |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 1-[2-[(4-fluorophenyl)methylsulfanyl]-3H-benzimidazol-5-yl]-3-naphthalen-2-ylurea |
| SMILES | O=C(Nc1ccc2ccccc2c1)Nc1ccc2nc(SCc3ccc(F)cc3)[nH]c2c1 |
| InChI | InChI=1S/C25H19FN4OS/c26-19-8-5-16(6-9-19)15-32-25-29-22-12-11-21(14-23(22)30-25)28-24(31)27-20-10-7-17-3-1-2-4-18(17)13-20/h1-14H,15H2,(H,29,30)(H2,27,28,31) |
| InChIKey | NHRYCWAWDWYPGQ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |