C22H32O2 — CID 15511448
(1S,4R,4aS,7S,8aR)-1,6-dimethyl-7-phenylmethoxy-4-propan-2-yl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-ol (PubChem CID 15511448) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is (1S,4R,4aS,7S,8aR)-1,6-dimethyl-7-phenylmethoxy-4-propan-2-yl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-ol.
| Compound Name | (1S,4R,4aS,7S,8aR)-1,6-dimethyl-7-phenylmethoxy-4-propan-2-yl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-ol |
|---|---|
| PubChem CID | 15511448 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (1S,4R,4aS,7S,8aR)-1,6-dimethyl-7-phenylmethoxy-4-propan-2-yl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-ol |
| SMILES | CC1=C[C@@H]2[C@@H](C(C)C)CC[C@](C)(O)[C@@H]2C[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C22H32O2/c1-15(2)18-10-11-22(4,23)20-13-21(16(3)12-19(18)20)24-14-17-8-6-5-7-9-17/h5-9,12,15,18-21,23H,10-11,13-14H2,1-4H3/t18-,19-,20-,21+,22+/m1/s1 |
| InChIKey | DWGOLVVMGDCZRM-YXIAPDDASA-N |
| XLogP | 4.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|