C24H26F2N6O3S2 — CID 155114505
5-[2-[[(2S)-3-[[5-(difluoromethylsulfanyl)pyrimidin-2-yl]amino]-2-methylpropyl]amino]-1,3-benzothiazole-6-carbonyl]-3,3a,4,6,7,7a-hexahydrofuro[3,4-c]pyridin-1-one (PubChem CID 155114505) has the molecular formula C24H26F2N6O3S2 and a molecular weight of 548.64 g/mol. Its IUPAC name is 5-[2-[[(2S)-3-[[5-(difluoromethylsulfanyl)pyrimidin-2-yl]amino]-2-methylpropyl]amino]-1,3-benzothiazole-6-carbonyl]-3,3a,4,6,7,7a-hexahydrofuro[3,4-c]pyridin-1-one.
| Compound Name | 5-[2-[[(2S)-3-[[5-(difluoromethylsulfanyl)pyrimidin-2-yl]amino]-2-methylpropyl]amino]-1,3-benzothiazole-6-carbonyl]-3,3a,4,6,7,7a-hexahydrofuro[3,4-c]pyridin-1-one |
|---|---|
| PubChem CID | 155114505 |
| Molecular Formula | C24H26F2N6O3S2 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | 5-[2-[[(2S)-3-[[5-(difluoromethylsulfanyl)pyrimidin-2-yl]amino]-2-methylpropyl]amino]-1,3-benzothiazole-6-carbonyl]-3,3a,4,6,7,7a-hexahydrofuro[3,4-c]pyridin-1-one |
| SMILES | C[C@@H](CNc1ncc(SC(F)F)cn1)CNc1nc2ccc(C(=O)N3CCC4C(=O)OCC4C3)cc2s1 |
| InChI | InChI=1S/C24H26F2N6O3S2/c1-13(7-27-23-28-9-16(10-29-23)36-22(25)26)8-30-24-31-18-3-2-14(6-19(18)37-24)20(33)32-5-4-17-15(11-32)12-35-21(17)34/h2-3,6,9-10,13,15,17,22H,4-5,7-8,11-12H2,1H3,(H,30,31)(H,27,28,29)/t13-,15?,17?/m0/s1 |
| InChIKey | VVJXAORXAZMDAQ-KTAKPFMOSA-N |
| XLogP | 4.20 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |