C25H30N8O4 — CID 155114758
tert-butyl N-[(14R)-6,14-dimethyl-16-oxo-12-oxa-2,5,6,15,19,23,24-heptazapentacyclo[15.5.2.13,10.04,8.020,24]pentacosa-1(23),3(25),4,7,9,17,19,21-octaen-21-yl]-N-methylcarbamate (PubChem CID 155114758) has the molecular formula C25H30N8O4 and a molecular weight of 506.57 g/mol. Its IUPAC name is tert-butyl N-[(14R)-6,14-dimethyl-16-oxo-12-oxa-2,5,6,15,19,23,24-heptazapentacyclo[15.5.2.13,10.04,8.020,24]pentacosa-1(23),3(25),4,7,9,17,19,21-octaen-21-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(14R)-6,14-dimethyl-16-oxo-12-oxa-2,5,6,15,19,23,24-heptazapentacyclo[15.5.2.13,10.04,8.020,24]pentacosa-1(23),3(25),4,7,9,17,19,21-octaen-21-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 155114758 |
| Molecular Formula | C25H30N8O4 |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | tert-butyl N-[(14R)-6,14-dimethyl-16-oxo-12-oxa-2,5,6,15,19,23,24-heptazapentacyclo[15.5.2.13,10.04,8.020,24]pentacosa-1(23),3(25),4,7,9,17,19,21-octaen-21-yl]-N-methylcarbamate |
| SMILES | C[C@@H]1COCc2cc(c3nn(C)cc3c2)Nc2cc(N(C)C(=O)OC(C)(C)C)c3ncc(n3n2)C(=O)N1 |
| InChI | InChI=1S/C25H30N8O4/c1-14-12-36-13-15-7-16-11-31(5)30-21(16)17(8-15)28-20-9-18(32(6)24(35)37-25(2,3)4)22-26-10-19(23(34)27-14)33(22)29-20/h7-11,14H,12-13H2,1-6H3,(H,27,34)(H,28,29)/t14-/m1/s1 |
| InChIKey | QJAXNXNNUVHIAV-CQSZACIVSA-N |
| XLogP | 3.38 |
| TPSA | 127.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|