C20H22N8O2 — CID 155114762
(14R)-6,14-dimethyl-21-(methylamino)-12-oxa-2,5,6,15,19,23,24-heptazapentacyclo[15.5.2.13,10.04,8.020,24]pentacosa-1(23),3(25),4,7,9,17,19,21-octaen-16-one (PubChem CID 155114762) has the molecular formula C20H22N8O2 and a molecular weight of 406.45 g/mol. Its IUPAC name is (14R)-6,14-dimethyl-21-(methylamino)-12-oxa-2,5,6,15,19,23,24-heptazapentacyclo[15.5.2.13,10.04,8.020,24]pentacosa-1(23),3(25),4,7,9,17,19,21-octaen-16-one.
| Compound Name | (14R)-6,14-dimethyl-21-(methylamino)-12-oxa-2,5,6,15,19,23,24-heptazapentacyclo[15.5.2.13,10.04,8.020,24]pentacosa-1(23),3(25),4,7,9,17,19,21-octaen-16-one |
|---|---|
| PubChem CID | 155114762 |
| Molecular Formula | C20H22N8O2 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | (14R)-6,14-dimethyl-21-(methylamino)-12-oxa-2,5,6,15,19,23,24-heptazapentacyclo[15.5.2.13,10.04,8.020,24]pentacosa-1(23),3(25),4,7,9,17,19,21-octaen-16-one |
| SMILES | CNc1cc2nn3c(cnc13)C(=O)N[C@H](C)COCc1cc(c3nn(C)cc3c1)N2 |
| InChI | InChI=1S/C20H22N8O2/c1-11-9-30-10-12-4-13-8-27(3)26-18(13)14(5-12)24-17-6-15(21-2)19-22-7-16(20(29)23-11)28(19)25-17/h4-8,11,21H,9-10H2,1-3H3,(H,23,29)(H,24,25)/t11-/m1/s1 |
| InChIKey | CETHJKANXCFKRP-LLVKDONJSA-N |
| XLogP | 2.05 |
| TPSA | 110.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|