About 2,4-difluoro-6-[1-(2-hydroxyphenyl)imidazo[1,5-a]pyridin-3-yl]phenol
2,4-difluoro-6-[1-(2-hydroxyphenyl)imidazo[1,5-a]pyridin-3-yl]phenol (PubChem CID 155115028) has the molecular formula C19H12F2N2O2
and a molecular weight of 338.31 g/mol. Its IUPAC name is 2,4-difluoro-6-[1-(2-hydroxyphenyl)imidazo[1,5-a]pyridin-3-yl]phenol.
Molecular Properties
| Compound Name | 2,4-difluoro-6-[1-(2-hydroxyphenyl)imidazo[1,5-a]pyridin-3-yl]phenol |
| PubChem CID | 155115028 |
| Molecular Formula | C19H12F2N2O2 |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 2,4-difluoro-6-[1-(2-hydroxyphenyl)imidazo[1,5-a]pyridin-3-yl]phenol |
| SMILES | Oc1ccccc1-c1nc(-c2cc(F)cc(F)c2O)n2ccccc12 |
| InChI | InChI=1S/C19H12F2N2O2/c20-11-9-13(18(25)14(21)10-11)19-22-17(12-5-1-2-7-16(12)24)15-6-3-4-8-23(15)19/h1-10,24-25H |
| InChIKey | GJQNXBVGFITFDK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 57.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-difluoro-6-[1-(2-hydroxyphenyl)imidazo[1,5-a]pyridin-3-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-difluoro-6-[1-(2-hydroxyphenyl)imidazo[1,5-a]pyridin-3-yl]phenol?
The IUPAC name of 2,4-difluoro-6-[1-(2-hydroxyphenyl)imidazo[1,5-a]pyridin-3-yl]phenol (CID 155115028) is 2,4-difluoro-6-[1-(2-hydroxyphenyl)imidazo[1,5-a]pyridin-3-yl]phenol.
What is the SMILES notation for 2,4-difluoro-6-[1-(2-hydroxyphenyl)imidazo[1,5-a]pyridin-3-yl]phenol?
The canonical SMILES for 2,4-difluoro-6-[1-(2-hydroxyphenyl)imidazo[1,5-a]pyridin-3-yl]phenol is Oc1ccccc1-c1nc(-c2cc(F)cc(F)c2O)n2ccccc12.
What is the InChIKey of 2,4-difluoro-6-[1-(2-hydroxyphenyl)imidazo[1,5-a]pyridin-3-yl]phenol?
The InChIKey is GJQNXBVGFITFDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12F2N2O2/c20-11-9-13(18(25)14(21)10-11)19-22-17(12-5-1-2-7-16(12)24)15-6-3-4-8-23(15)19/h1-10,24-25H.
What are the key properties of 2,4-difluoro-6-[1-(2-hydroxyphenyl)imidazo[1,5-a]pyridin-3-yl]phenol?
2,4-difluoro-6-[1-(2-hydroxyphenyl)imidazo[1,5-a]pyridin-3-yl]phenol has a molecular weight of 338.31 g/mol, XLogP of 4.36, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-difluoro-6-[1-(2-hydroxyphenyl)imidazo[1,5-a]pyridin-3-yl]phenol is sourced from PubChem (CID 155115028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).