About N-[2-[2-[2-(4,5-dihydroimidazol-1-yl)ethylamino]ethyl-formylamino]ethyl]formamide
N-[2-[2-[2-(4,5-dihydroimidazol-1-yl)ethylamino]ethyl-formylamino]ethyl]formamide (PubChem CID 155115202) has the molecular formula C11H21N5O2
and a molecular weight of 255.32 g/mol. Its IUPAC name is N-[2-[2-[2-(4,5-dihydroimidazol-1-yl)ethylamino]ethyl-formylamino]ethyl]formamide.
Molecular Properties
| Compound Name | N-[2-[2-[2-(4,5-dihydroimidazol-1-yl)ethylamino]ethyl-formylamino]ethyl]formamide |
| PubChem CID | 155115202 |
| Molecular Formula | C11H21N5O2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | N-[2-[2-[2-(4,5-dihydroimidazol-1-yl)ethylamino]ethyl-formylamino]ethyl]formamide |
| SMILES | O=CNCCN(C=O)CCNCCN1C=NCC1 |
| InChI | InChI=1S/C11H21N5O2/c17-10-14-4-8-16(11-18)7-2-12-1-5-15-6-3-13-9-15/h9-12H,1-8H2,(H,14,17) |
| InChIKey | CQYJNLQBJCVQCC-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[2-[2-(4,5-dihydroimidazol-1-yl)ethylamino]ethyl-formylamino]ethyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[2-[2-(4,5-dihydroimidazol-1-yl)ethylamino]ethyl-formylamino]ethyl]formamide?
The IUPAC name of N-[2-[2-[2-(4,5-dihydroimidazol-1-yl)ethylamino]ethyl-formylamino]ethyl]formamide (CID 155115202) is N-[2-[2-[2-(4,5-dihydroimidazol-1-yl)ethylamino]ethyl-formylamino]ethyl]formamide.
What is the SMILES notation for N-[2-[2-[2-(4,5-dihydroimidazol-1-yl)ethylamino]ethyl-formylamino]ethyl]formamide?
The canonical SMILES for N-[2-[2-[2-(4,5-dihydroimidazol-1-yl)ethylamino]ethyl-formylamino]ethyl]formamide is O=CNCCN(C=O)CCNCCN1C=NCC1.
What is the InChIKey of N-[2-[2-[2-(4,5-dihydroimidazol-1-yl)ethylamino]ethyl-formylamino]ethyl]formamide?
The InChIKey is CQYJNLQBJCVQCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N5O2/c17-10-14-4-8-16(11-18)7-2-12-1-5-15-6-3-13-9-15/h9-12H,1-8H2,(H,14,17).
What are the key properties of N-[2-[2-[2-(4,5-dihydroimidazol-1-yl)ethylamino]ethyl-formylamino]ethyl]formamide?
N-[2-[2-[2-(4,5-dihydroimidazol-1-yl)ethylamino]ethyl-formylamino]ethyl]formamide has a molecular weight of 255.32 g/mol, XLogP of -1.88, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[2-[2-(4,5-dihydroimidazol-1-yl)ethylamino]ethyl-formylamino]ethyl]formamide is sourced from PubChem (CID 155115202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).